C14H14N2O2 — CID 21188425
4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 21188425) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 21188425 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-phenyl-4,10-diazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CCC(N3)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2/c17-13-11-9-6-7-10(15-9)12(11)14(18)16(13)8-4-2-1-3-5-8/h1-5,9-12,15H,6-7H2 |
| InChIKey | TWXKHEYMGIXDPA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|