About (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid
(3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid (PubChem CID 21189086) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid.
Molecular Properties
| Compound Name | (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid |
| PubChem CID | 21189086 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid |
| SMILES | C=C(C)c1ccc(OC(C)=O)cc1C.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14O2.C8H8O2/c1-8(2)12-6-5-11(7-9(12)3)14-10(4)13;9-8(10)6-7-4-2-1-3-5-7/h5-7H,1H2,2-4H3;1-5H,6H2,(H,9,10) |
| InChIKey | YWWZXNLFWKZKCK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid?
The IUPAC name of (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid (CID 21189086) is (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid.
What is the SMILES notation for (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid?
The canonical SMILES for (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid is C=C(C)c1ccc(OC(C)=O)cc1C.O=C(O)Cc1ccccc1.
What is the InChIKey of (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid?
The InChIKey is YWWZXNLFWKZKCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2.C8H8O2/c1-8(2)12-6-5-11(7-9(12)3)14-10(4)13;9-8(10)6-7-4-2-1-3-5-7/h5-7H,1H2,2-4H3;1-5H,6H2,(H,9,10).
What are the key properties of (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid?
(3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid has a molecular weight of 326.39 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-prop-1-en-2-ylphenyl) acetate;2-phenylacetic acid is sourced from PubChem (CID 21189086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).