C18H30O2S — CID 21189490
3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid (PubChem CID 21189490) has the molecular formula C18H30O2S and a molecular weight of 310.50 g/mol. Its IUPAC name is 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid.
| Compound Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 21189490 |
| Molecular Formula | C18H30O2S |
| Molecular Weight | 310.50 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCCC(=O)O |
| InChI | InChI=1S/C18H30O2S/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-13-21-14-12-18(19)20/h7,9,11H,5-6,8,10,12-14H2,1-4H3,(H,19,20)/b16-9+,17-11+ |
| InChIKey | HSOBUDCLIVJMDO-BTMZFSHUSA-N |
| XLogP | 5.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|