C24H31NO4 — CID 21189771
6-[4-methoxy-3-(5-phenylpentoxy)phenyl]-3,6-dimethyl-1,3-oxazinan-2-one (PubChem CID 21189771) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 6-[4-methoxy-3-(5-phenylpentoxy)phenyl]-3,6-dimethyl-1,3-oxazinan-2-one.
| Compound Name | 6-[4-methoxy-3-(5-phenylpentoxy)phenyl]-3,6-dimethyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 21189771 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 6-[4-methoxy-3-(5-phenylpentoxy)phenyl]-3,6-dimethyl-1,3-oxazinan-2-one |
| SMILES | COc1ccc(C2(C)CCN(C)C(=O)O2)cc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C24H31NO4/c1-24(15-16-25(2)23(26)29-24)20-13-14-21(27-3)22(18-20)28-17-9-5-8-12-19-10-6-4-7-11-19/h4,6-7,10-11,13-14,18H,5,8-9,12,15-17H2,1-3H3 |
| InChIKey | YHKJYRBSALDNQR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|