C10H4F4N2O4 — CID 21189989
2-(5,6,7,8-tetrafluoro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid (PubChem CID 21189989) has the molecular formula C10H4F4N2O4 and a molecular weight of 292.14 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrafluoro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid.
| Compound Name | 2-(5,6,7,8-tetrafluoro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
|---|---|
| PubChem CID | 21189989 |
| Molecular Formula | C10H4F4N2O4 |
| Molecular Weight | 292.14 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-(5,6,7,8-tetrafluoro-2,3-dioxo-4H-quinoxalin-1-yl)acetic acid |
| SMILES | O=C(O)Cn1c(=O)c(=O)[nH]c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C10H4F4N2O4/c11-3-4(12)6(14)8-7(5(3)13)15-9(19)10(20)16(8)1-2(17)18/h1H2,(H,15,19)(H,17,18) |
| InChIKey | YWLCYFKGRKJVHM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|