C14H13F3N4O4S — CID 21190133
N-[4-(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)butyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 21190133) has the molecular formula C14H13F3N4O4S and a molecular weight of 390.34 g/mol. Its IUPAC name is N-[4-(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)butyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)butyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 21190133 |
| Molecular Formula | C14H13F3N4O4S |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[4-(5,7-dioxo-2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-6-yl)butyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=c1c2cccc3ncc(c(=O)n1CCCCNS(=O)(=O)C(F)(F)F)n32 |
| InChI | InChI=1S/C14H13F3N4O4S/c15-14(16,17)26(24,25)19-6-1-2-7-20-12(22)9-4-3-5-11-18-8-10(13(20)23)21(9)11/h3-5,8,19H,1-2,6-7H2 |
| InChIKey | OUNRJBSXHBDOEF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|