C20H32N6O5S — CID 21190518
[4-[7-(butylamino)-5-propylsulfonyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 21190518) has the molecular formula C20H32N6O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is [4-[7-(butylamino)-5-propylsulfonyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [4-[7-(butylamino)-5-propylsulfonyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 21190518 |
| Molecular Formula | C20H32N6O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [4-[7-(butylamino)-5-propylsulfonyltriazolo[4,5-d]pyrimidin-3-yl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CCCCNc1nc(S(=O)(=O)CCC)nc2c1nnn2C1CC(CO)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C20H32N6O5S/c1-5-7-8-21-17-14-18(23-19(22-17)32(28,29)9-6-2)26(25-24-14)13-10-12(11-27)15-16(13)31-20(3,4)30-15/h12-13,15-16,27H,5-11H2,1-4H3,(H,21,22,23) |
| InChIKey | DPRBUKCXSQTYBG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|