About 2-cyclobutyloxy-3,4-difluorobenzamide
2-cyclobutyloxy-3,4-difluorobenzamide (PubChem CID 21191364) has the molecular formula C11H11F2NO2
and a molecular weight of 227.21 g/mol. Its IUPAC name is 2-cyclobutyloxy-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | 2-cyclobutyloxy-3,4-difluorobenzamide |
| PubChem CID | 21191364 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-cyclobutyloxy-3,4-difluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(F)c1OC1CCC1 |
| InChI | InChI=1S/C11H11F2NO2/c12-8-5-4-7(11(14)15)10(9(8)13)16-6-2-1-3-6/h4-6H,1-3H2,(H2,14,15) |
| InChIKey | JJXHAHBEWWVCMY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutyloxy-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyloxy-3,4-difluorobenzamide?
The IUPAC name of 2-cyclobutyloxy-3,4-difluorobenzamide (CID 21191364) is 2-cyclobutyloxy-3,4-difluorobenzamide.
What is the SMILES notation for 2-cyclobutyloxy-3,4-difluorobenzamide?
The canonical SMILES for 2-cyclobutyloxy-3,4-difluorobenzamide is NC(=O)c1ccc(F)c(F)c1OC1CCC1.
What is the InChIKey of 2-cyclobutyloxy-3,4-difluorobenzamide?
The InChIKey is JJXHAHBEWWVCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO2/c12-8-5-4-7(11(14)15)10(9(8)13)16-6-2-1-3-6/h4-6H,1-3H2,(H2,14,15).
What are the key properties of 2-cyclobutyloxy-3,4-difluorobenzamide?
2-cyclobutyloxy-3,4-difluorobenzamide has a molecular weight of 227.21 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyloxy-3,4-difluorobenzamide is sourced from PubChem (CID 21191364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).