C23H26F3N5O5 — CID 21191427
3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid (PubChem CID 21191427) has the molecular formula C23H26F3N5O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is 3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 21191427 |
| Molecular Formula | C23H26F3N5O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]-2-(2-methylpropoxycarbonylamino)propanoic acid |
| SMILES | CC(C)COC(=O)NC(Cc1ccc(NC(=O)c2cc(/N=C/NN)cc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C23H26F3N5O5/c1-13(2)11-36-22(35)31-19(21(33)34)7-14-3-5-17(6-4-14)30-20(32)15-8-16(23(24,25)26)10-18(9-15)28-12-29-27/h3-6,8-10,12-13,19H,7,11,27H2,1-2H3,(H,28,29)(H,30,32)(H,31,35)(H,33,34) |
| InChIKey | KRRQTWUJZJLGSG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|