C24H28F3N5O4 — CID 21191484
2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid (PubChem CID 21191484) has the molecular formula C24H28F3N5O4 and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid.
| Compound Name | 2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 21191484 |
| Molecular Formula | C24H28F3N5O4 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-(3,3-dimethylbutanoylamino)-3-[4-[[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)(C)CC(=O)NC(Cc1ccc(NC(=O)c2cc(/N=C/NN)cc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C24H28F3N5O4/c1-23(2,3)12-20(33)32-19(22(35)36)8-14-4-6-17(7-5-14)31-21(34)15-9-16(24(25,26)27)11-18(10-15)29-13-30-28/h4-7,9-11,13,19H,8,12,28H2,1-3H3,(H,29,30)(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | AZTXMOGSUZNPFT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|