About 1-ethyl-1,2-dimethylguanidine
1-ethyl-1,2-dimethylguanidine (PubChem CID 21191499) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-ethyl-1,2-dimethylguanidine |
| PubChem CID | 21191499 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 1-ethyl-1,2-dimethylguanidine |
| SMILES | CCN(C)/C(N)=N/C |
| InChI | InChI=1S/C5H13N3/c1-4-8(3)5(6)7-2/h4H2,1-3H3,(H2,6,7) |
| InChIKey | RMWXQMGADHAFMU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,2-dimethylguanidine?
The IUPAC name of 1-ethyl-1,2-dimethylguanidine (CID 21191499) is 1-ethyl-1,2-dimethylguanidine.
What is the SMILES notation for 1-ethyl-1,2-dimethylguanidine?
The canonical SMILES for 1-ethyl-1,2-dimethylguanidine is CCN(C)/C(N)=N/C.
What is the InChIKey of 1-ethyl-1,2-dimethylguanidine?
The InChIKey is RMWXQMGADHAFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3/c1-4-8(3)5(6)7-2/h4H2,1-3H3,(H2,6,7).
What are the key properties of 1-ethyl-1,2-dimethylguanidine?
1-ethyl-1,2-dimethylguanidine has a molecular weight of 115.18 g/mol, XLogP of -0.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,2-dimethylguanidine is sourced from PubChem (CID 21191499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).