About 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine
2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 21192079) has the molecular formula C12H15F3N4
and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 21192079 |
| Molecular Formula | C12H15F3N4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | Cc1cc(C(F)(F)F)nc2c(N)c(C(C)(C)C)nn12 |
| InChI | InChI=1S/C12H15F3N4/c1-6-5-7(12(13,14)15)17-10-8(16)9(11(2,3)4)18-19(6)10/h5H,16H2,1-4H3 |
| InChIKey | TYVSWKIXUUKRAQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine (CID 21192079) is 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is Cc1cc(C(F)(F)F)nc2c(N)c(C(C)(C)C)nn12.
What is the InChIKey of 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is TYVSWKIXUUKRAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N4/c1-6-5-7(12(13,14)15)17-10-8(16)9(11(2,3)4)18-19(6)10/h5H,16H2,1-4H3.
What are the key properties of 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine?
2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 272.27 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-7-methyl-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 21192079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).