About 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate
3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (PubChem CID 21192780) has the molecular formula C22H25FN4O3
and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 21192780 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate |
| SMILES | NC1=NC2(CCN(C(=O)OCCCOc3ccccc3)CC2)Nc2cccc(F)c21 |
| InChI | InChI=1S/C22H25FN4O3/c23-17-8-4-9-18-19(17)20(24)26-22(25-18)10-12-27(13-11-22)21(28)30-15-5-14-29-16-6-2-1-3-7-16/h1-4,6-9,25H,5,10-15H2,(H2,24,26) |
| InChIKey | ASRPSFSSAFCIJP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate (CID 21192780) is 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is NC1=NC2(CCN(C(=O)OCCCOc3ccccc3)CC2)Nc2cccc(F)c21.
What is the InChIKey of 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
The InChIKey is ASRPSFSSAFCIJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25FN4O3/c23-17-8-4-9-18-19(17)20(24)26-22(25-18)10-12-27(13-11-22)21(28)30-15-5-14-29-16-6-2-1-3-7-16/h1-4,6-9,25H,5,10-15H2,(H2,24,26).
What are the key properties of 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate?
3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate has a molecular weight of 412.47 g/mol, XLogP of 3.35, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxypropyl 4-amino-5-fluorospiro[1H-quinazoline-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 21192780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).