C30H30N4O — CID 21193215
4-[[5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 21193215) has the molecular formula C30H30N4O and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[[5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 21193215 |
| Molecular Formula | C30H30N4O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 4-[[5-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2cncc2CN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H30N4O/c31-19-24-11-13-25(14-12-24)21-34-23-32-20-29(34)22-33-17-15-28(16-18-33)30(35,26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-14,20,23,28,35H,15-18,21-22H2 |
| InChIKey | NPGCHQPWWAHNSP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |