About 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one
3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one (PubChem CID 21193469) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one |
| PubChem CID | 21193469 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one |
| SMILES | O=c1ocnn1C1CCNC1 |
| InChI | InChI=1S/C6H9N3O2/c10-6-9(8-4-11-6)5-1-2-7-3-5/h4-5,7H,1-3H2 |
| InChIKey | YBWBZZUMJVFILK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one?
The IUPAC name of 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one (CID 21193469) is 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one?
The canonical SMILES for 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one is O=c1ocnn1C1CCNC1.
What is the InChIKey of 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one?
The InChIKey is YBWBZZUMJVFILK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c10-6-9(8-4-11-6)5-1-2-7-3-5/h4-5,7H,1-3H2.
What are the key properties of 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one?
3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one has a molecular weight of 155.16 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-3-yl-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 21193469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).