C23H30N10O2 — CID 21195032
1-N',5-N'-bis(3-acetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide (PubChem CID 21195032) has the molecular formula C23H30N10O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is 1-N',5-N'-bis(3-acetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide.
| Compound Name | 1-N',5-N'-bis(3-acetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide |
|---|---|
| PubChem CID | 21195032 |
| Molecular Formula | C23H30N10O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 1-N',5-N'-bis(3-acetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide |
| SMILES | CC(=O)c1cccc(/N=C(/CCC/C(=N\c2cccc(C(C)=O)c2)NN=C(N)N)NN=C(N)N)c1 |
| InChI | InChI=1S/C23H30N10O2/c1-14(34)16-6-3-8-18(12-16)28-20(30-32-22(24)25)10-5-11-21(31-33-23(26)27)29-19-9-4-7-17(13-19)15(2)35/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H,28,30)(H,29,31)(H4,24,25,32)(H4,26,27,33) |
| InChIKey | FEXOLAOEFJXUDT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 211.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|