C23H19N3O2 — CID 21195138
[6-[4-(4-methoxyphenyl)-6-pyridin-2-yl-2-pyridinyl]-2-pyridinyl]methanol (PubChem CID 21195138) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is [6-[4-(4-methoxyphenyl)-6-pyridin-2-yl-2-pyridinyl]-2-pyridinyl]methanol.
| Compound Name | [6-[4-(4-methoxyphenyl)-6-pyridin-2-yl-2-pyridinyl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 21195138 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [6-[4-(4-methoxyphenyl)-6-pyridin-2-yl-2-pyridinyl]-2-pyridinyl]methanol |
| SMILES | COc1ccc(-c2cc(-c3ccccn3)nc(-c3cccc(CO)n3)c2)cc1 |
| InChI | InChI=1S/C23H19N3O2/c1-28-19-10-8-16(9-11-19)17-13-22(20-6-2-3-12-24-20)26-23(14-17)21-7-4-5-18(15-27)25-21/h2-14,27H,15H2,1H3 |
| InChIKey | OFGNZQHSXRSJDG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |