About 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid (PubChem CID 21195141) has the molecular formula C16H22N2O8
and a molecular weight of 370.36 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid |
| PubChem CID | 21195141 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid |
| SMILES | O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C(O)CCC(=O)NO |
| InChI | InChI=1S/C12H15NO4.C4H7NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;6-3(5-9)1-2-4(7)8/h5-6,8-9H,1-4,7H2,(H,16,17);9H,1-2H2,(H,5,6)(H,7,8) |
| InChIKey | MIUNTVPVOXHSKQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid?
The IUPAC name of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid (CID 21195141) is 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid.
What is the SMILES notation for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid?
The canonical SMILES for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid is O=C(O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C(O)CCC(=O)NO.
What is the InChIKey of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid?
The InChIKey is MIUNTVPVOXHSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4.C4H7NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17;6-3(5-9)1-2-4(7)8/h5-6,8-9H,1-4,7H2,(H,16,17);9H,1-2H2,(H,5,6)(H,7,8).
What are the key properties of 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid?
4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid has a molecular weight of 370.36 g/mol, XLogP of 0.16, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxylic acid;4-(hydroxyamino)-4-oxobutanoic acid is sourced from PubChem (CID 21195141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).