C14H13F15O4 — CID 21195195
1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hex-5-en-2-ol (PubChem CID 21195195) has the molecular formula C14H13F15O4 and a molecular weight of 530.22 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hex-5-en-2-ol.
| Compound Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hex-5-en-2-ol |
|---|---|
| PubChem CID | 21195195 |
| Molecular Formula | C14H13F15O4 |
| Molecular Weight | 530.22 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hex-5-en-2-ol |
| SMILES | C=CCCC(O)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F15O4/c1-2-3-4-7(30)5-31-6-8(15,16)32-13(26,27)14(28,29)33-12(24,25)10(19,20)9(17,18)11(21,22)23/h2,7,30H,1,3-6H2 |
| InChIKey | BIFKQKQJHFSOBQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|