C14H12F16O3 — CID 21195200
6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-fluorohex-1-ene (PubChem CID 21195200) has the molecular formula C14H12F16O3 and a molecular weight of 532.22 g/mol. Its IUPAC name is 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-fluorohex-1-ene.
| Compound Name | 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-fluorohex-1-ene |
|---|---|
| PubChem CID | 21195200 |
| Molecular Formula | C14H12F16O3 |
| Molecular Weight | 532.22 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-5-fluorohex-1-ene |
| SMILES | C=CCCC(F)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F16O3/c1-2-3-4-7(15)5-31-6-8(16,17)32-13(27,28)14(29,30)33-12(25,26)10(20,21)9(18,19)11(22,23)24/h2,7H,1,3-6H2 |
| InChIKey | QFSXPRWHTXTXLV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.22 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|