C16H21F11O4 — CID 21195201
1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]dec-9-en-2-ol (PubChem CID 21195201) has the molecular formula C16H21F11O4 and a molecular weight of 486.32 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]dec-9-en-2-ol.
| Compound Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]dec-9-en-2-ol |
|---|---|
| PubChem CID | 21195201 |
| Molecular Formula | C16H21F11O4 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]dec-9-en-2-ol |
| SMILES | C=CCCCCCCC(O)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H21F11O4/c1-2-3-4-5-6-7-8-11(28)9-29-10-12(17,18)30-15(24,25)16(26,27)31-14(22,23)13(19,20)21/h2,11,28H,1,3-10H2 |
| InChIKey | SKNVOHKIBWJYPH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|