C13H17F9O3 — CID 21195202
1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]oct-7-en-2-ol (PubChem CID 21195202) has the molecular formula C13H17F9O3 and a molecular weight of 392.26 g/mol. Its IUPAC name is 1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]oct-7-en-2-ol.
| Compound Name | 1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]oct-7-en-2-ol |
|---|---|
| PubChem CID | 21195202 |
| Molecular Formula | C13H17F9O3 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]oct-7-en-2-ol |
| SMILES | C=CCCCCC(O)COCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F9O3/c1-2-3-4-5-6-9(23)7-24-8-10(14,15)12(19,20)25-13(21,22)11(16,17)18/h2,9,23H,1,3-8H2 |
| InChIKey | HQNYOPYAEMLQES-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|