C16H17F15O4 — CID 21195206
1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]oct-7-en-2-ol (PubChem CID 21195206) has the molecular formula C16H17F15O4 and a molecular weight of 558.28 g/mol. Its IUPAC name is 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]oct-7-en-2-ol.
| Compound Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]oct-7-en-2-ol |
|---|---|
| PubChem CID | 21195206 |
| Molecular Formula | C16H17F15O4 |
| Molecular Weight | 558.28 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 1-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]oct-7-en-2-ol |
| SMILES | C=CCCCCC(O)COCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F15O4/c1-2-3-4-5-6-9(32)7-33-8-10(17,18)34-15(28,29)16(30,31)35-14(26,27)12(21,22)11(19,20)13(23,24)25/h2,9,32H,1,3-8H2 |
| InChIKey | WOUIGXWBMBXIAE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.28 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|