C20H34O3 — CID 21195529
2-methyl-3-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methoxymethyl]-2-(4-methylpent-3-enyl)oxirane (PubChem CID 21195529) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is 2-methyl-3-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methoxymethyl]-2-(4-methylpent-3-enyl)oxirane.
| Compound Name | 2-methyl-3-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methoxymethyl]-2-(4-methylpent-3-enyl)oxirane |
|---|---|
| PubChem CID | 21195529 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 2-methyl-3-[[3-methyl-3-(4-methylpent-3-enyl)oxiran-2-yl]methoxymethyl]-2-(4-methylpent-3-enyl)oxirane |
| SMILES | CC(C)=CCCC1(C)OC1COCC1OC1(C)CCC=C(C)C |
| InChI | InChI=1S/C20H34O3/c1-15(2)9-7-11-19(5)17(22-19)13-21-14-18-20(6,23-18)12-8-10-16(3)4/h9-10,17-18H,7-8,11-14H2,1-6H3 |
| InChIKey | LWZSLTMLUKXKDF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|