C30H26F3NO4S — CID 21196536
[3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-5-methylphenyl] trifluoromethanesulfonate (PubChem CID 21196536) has the molecular formula C30H26F3NO4S and a molecular weight of 553.60 g/mol. Its IUPAC name is [3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-5-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-5-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21196536 |
| Molecular Formula | C30H26F3NO4S |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | [3-[[2-(4,5-diphenyl-1,3-oxazol-2-yl)cyclohex-2-en-1-yl]methyl]-5-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(CC2CCCC=C2c2nc(-c3ccccc3)c(-c3ccccc3)o2)cc(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C30H26F3NO4S/c1-20-16-21(19-25(17-20)38-39(35,36)30(31,32)33)18-24-14-8-9-15-26(24)29-34-27(22-10-4-2-5-11-22)28(37-29)23-12-6-3-7-13-23/h2-7,10-13,15-17,19,24H,8-9,14,18H2,1H3 |
| InChIKey | XOMRXSOWIYIPOS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|