C12H8F3N5O — CID 21196638
1-(2-azido-3,3,3-trifluoropropyl)furo[2,3-g]indazole (PubChem CID 21196638) has the molecular formula C12H8F3N5O and a molecular weight of 295.22 g/mol. Its IUPAC name is 1-(2-azido-3,3,3-trifluoropropyl)furo[2,3-g]indazole.
| Compound Name | 1-(2-azido-3,3,3-trifluoropropyl)furo[2,3-g]indazole |
|---|---|
| PubChem CID | 21196638 |
| Molecular Formula | C12H8F3N5O |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(2-azido-3,3,3-trifluoropropyl)furo[2,3-g]indazole |
| SMILES | [N-]=[N+]=NC(Cn1ncc2ccc3occc3c21)C(F)(F)F |
| InChI | InChI=1S/C12H8F3N5O/c13-12(14,15)10(18-19-16)6-20-11-7(5-17-20)1-2-9-8(11)3-4-21-9/h1-5,10H,6H2 |
| InChIKey | ISEMYYUYFXCHMN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 79.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|