About 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride
2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride (PubChem CID 21196780) has the molecular formula C11H14ClN3S
and a molecular weight of 255.77 g/mol. Its IUPAC name is 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride |
| PubChem CID | 21196780 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCn1ncc2c1-c1ccsc1CC2 |
| InChI | InChI=1S/C11H13N3S.ClH/c12-4-5-14-11-8(7-13-14)1-2-10-9(11)3-6-15-10;/h3,6-7H,1-2,4-5,12H2;1H |
| InChIKey | XDIVSRQQIWCNFB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride (CID 21196780) is 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride is Cl.NCCn1ncc2c1-c1ccsc1CC2.
What is the InChIKey of 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride?
The InChIKey is XDIVSRQQIWCNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S.ClH/c12-4-5-14-11-8(7-13-14)1-2-10-9(11)3-6-15-10;/h3,6-7H,1-2,4-5,12H2;1H.
What are the key properties of 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride?
2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride has a molecular weight of 255.77 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydrothieno[2,3-g]indazol-1-yl)ethanamine;hydrochloride is sourced from PubChem (CID 21196780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).