C22H33ClO2 — CID 21196832
1-chloroethyl (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate (PubChem CID 21196832) has the molecular formula C22H33ClO2 and a molecular weight of 364.96 g/mol. Its IUPAC name is 1-chloroethyl (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate.
| Compound Name | 1-chloroethyl (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 21196832 |
| Molecular Formula | C22H33ClO2 |
| Molecular Weight | 364.96 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-chloroethyl (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)OC(C)Cl |
| InChI | InChI=1S/C22H33ClO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(24)25-21(2)23/h4-5,7-8,10-11,13-14,16-17,21H,3,6,9,12,15,18-20H2,1-2H3/b5-4+,8-7+,11-10+,14-13+,17-16+ |
| InChIKey | JTRWJHJWPVCOMO-ZACMJQCDSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.96 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|