About 2-(undecanoylamino)ethyl prop-2-enoate
2-(undecanoylamino)ethyl prop-2-enoate (PubChem CID 21196858) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-(undecanoylamino)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(undecanoylamino)ethyl prop-2-enoate |
| PubChem CID | 21196858 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 2-(undecanoylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C16H29NO3/c1-3-5-6-7-8-9-10-11-12-15(18)17-13-14-20-16(19)4-2/h4H,2-3,5-14H2,1H3,(H,17,18) |
| InChIKey | KLNHMCWEHXWXOR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(undecanoylamino)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(undecanoylamino)ethyl prop-2-enoate?
The IUPAC name of 2-(undecanoylamino)ethyl prop-2-enoate (CID 21196858) is 2-(undecanoylamino)ethyl prop-2-enoate.
What is the SMILES notation for 2-(undecanoylamino)ethyl prop-2-enoate?
The canonical SMILES for 2-(undecanoylamino)ethyl prop-2-enoate is C=CC(=O)OCCNC(=O)CCCCCCCCCC.
What is the InChIKey of 2-(undecanoylamino)ethyl prop-2-enoate?
The InChIKey is KLNHMCWEHXWXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-3-5-6-7-8-9-10-11-12-15(18)17-13-14-20-16(19)4-2/h4H,2-3,5-14H2,1H3,(H,17,18).
What are the key properties of 2-(undecanoylamino)ethyl prop-2-enoate?
2-(undecanoylamino)ethyl prop-2-enoate has a molecular weight of 283.41 g/mol, XLogP of 3.36, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(undecanoylamino)ethyl prop-2-enoate is sourced from PubChem (CID 21196858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).