About 1-bromoanthracen-9-ol;methane
1-bromoanthracen-9-ol;methane (PubChem CID 21197331) has the molecular formula C15H13BrO
and a molecular weight of 289.17 g/mol. Its IUPAC name is 1-bromoanthracen-9-ol;methane.
Molecular Properties
| Compound Name | 1-bromoanthracen-9-ol;methane |
| PubChem CID | 21197331 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1-bromoanthracen-9-ol;methane |
| SMILES | C.Oc1c2ccccc2cc2cccc(Br)c12 |
| InChI | InChI=1S/C14H9BrO.CH4/c15-12-7-3-5-10-8-9-4-1-2-6-11(9)14(16)13(10)12;/h1-8,16H;1H4 |
| InChIKey | HYIMKPIPRAMJDU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-bromoanthracen-9-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromoanthracen-9-ol;methane?
The IUPAC name of 1-bromoanthracen-9-ol;methane (CID 21197331) is 1-bromoanthracen-9-ol;methane.
What is the SMILES notation for 1-bromoanthracen-9-ol;methane?
The canonical SMILES for 1-bromoanthracen-9-ol;methane is C.Oc1c2ccccc2cc2cccc(Br)c12.
What is the InChIKey of 1-bromoanthracen-9-ol;methane?
The InChIKey is HYIMKPIPRAMJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrO.CH4/c15-12-7-3-5-10-8-9-4-1-2-6-11(9)14(16)13(10)12;/h1-8,16H;1H4.
What are the key properties of 1-bromoanthracen-9-ol;methane?
1-bromoanthracen-9-ol;methane has a molecular weight of 289.17 g/mol, XLogP of 5.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromoanthracen-9-ol;methane is sourced from PubChem (CID 21197331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).