About 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane
2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane (PubChem CID 21197455) has the molecular formula C16H30
and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane |
| PubChem CID | 21197455 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane |
| SMILES | CC1CCC(C)C(C(C)C2CCCCC2)C1 |
| InChI | InChI=1S/C16H30/c1-12-9-10-13(2)16(11-12)14(3)15-7-5-4-6-8-15/h12-16H,4-11H2,1-3H3 |
| InChIKey | PYFNMPMCFNJXAU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane?
The IUPAC name of 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane (CID 21197455) is 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane.
What is the SMILES notation for 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane?
The canonical SMILES for 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane is CC1CCC(C)C(C(C)C2CCCCC2)C1.
What is the InChIKey of 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane?
The InChIKey is PYFNMPMCFNJXAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30/c1-12-9-10-13(2)16(11-12)14(3)15-7-5-4-6-8-15/h12-16H,4-11H2,1-3H3.
What are the key properties of 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane?
2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane has a molecular weight of 222.42 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexylethyl)-1,4-dimethylcyclohexane is sourced from PubChem (CID 21197455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).