C25H25N3O4S2 — CID 2119777
2-[[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2119777) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 2-[[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2119777 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-[[3-[phenyl(prop-2-enyl)sulfamoyl]benzoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1cccc(C(=O)Nc2sc3c(c2C(N)=O)CCCC3)c1 |
| InChI | InChI=1S/C25H25N3O4S2/c1-2-15-28(18-10-4-3-5-11-18)34(31,32)19-12-8-9-17(16-19)24(30)27-25-22(23(26)29)20-13-6-7-14-21(20)33-25/h2-5,8-12,16H,1,6-7,13-15H2,(H2,26,29)(H,27,30) |
| InChIKey | FKPSPEDKBQIPDB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|