C13H16F4N2O2 — CID 21198201
ethyl 2-[ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate (PubChem CID 21198201) has the molecular formula C13H16F4N2O2 and a molecular weight of 308.28 g/mol. Its IUPAC name is ethyl 2-[ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 21198201 |
| Molecular Formula | C13H16F4N2O2 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl 2-[ethyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)N(CC)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H16F4N2O2/c1-5-19(13(3,4)12(20)21-6-2)9-7(14)10(16)18-11(17)8(9)15/h5-6H2,1-4H3 |
| InChIKey | XPPOWXPHZDBTTG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|