C13H15F4NO3 — CID 21198284
ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]pentanoate (PubChem CID 21198284) has the molecular formula C13H15F4NO3 and a molecular weight of 309.26 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]pentanoate.
| Compound Name | ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]pentanoate |
|---|---|
| PubChem CID | 21198284 |
| Molecular Formula | C13H15F4NO3 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | ethyl 4-methyl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)Oc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H15F4NO3/c1-4-20-13(19)7(5-6(2)3)21-10-8(14)11(16)18-12(17)9(10)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | NDUYIRDHPNRNGR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|