C17H25F4N3O2 — CID 21198289
ethyl 2-[4-(dimethylamino)butyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate (PubChem CID 21198289) has the molecular formula C17H25F4N3O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is ethyl 2-[4-(dimethylamino)butyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-(dimethylamino)butyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 21198289 |
| Molecular Formula | C17H25F4N3O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | ethyl 2-[4-(dimethylamino)butyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)N(CCCCN(C)C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C17H25F4N3O2/c1-6-26-16(25)17(2,3)24(10-8-7-9-23(4)5)13-11(18)14(20)22-15(21)12(13)19/h6-10H2,1-5H3 |
| InChIKey | YNUUPOHMEXREHZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|