About 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid
2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid (PubChem CID 21198651) has the molecular formula C10H18N6O4
and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid |
| PubChem CID | 21198651 |
| Molecular Formula | C10H18N6O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid |
| SMILES | NC1=NCCN1CC(=O)O.NC1=NCCN1CC(=O)O |
| InChI | InChI=1S/2C5H9N3O2/c2*6-5-7-1-2-8(5)3-4(9)10/h2*1-3H2,(H2,6,7)(H,9,10) |
| InChIKey | WBISTUASFKSUAY-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 157.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid?
The IUPAC name of 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid (CID 21198651) is 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid.
What is the SMILES notation for 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid?
The canonical SMILES for 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid is NC1=NCCN1CC(=O)O.NC1=NCCN1CC(=O)O.
What is the InChIKey of 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid?
The InChIKey is WBISTUASFKSUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9N3O2/c2*6-5-7-1-2-8(5)3-4(9)10/h2*1-3H2,(H2,6,7)(H,9,10).
What are the key properties of 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid?
2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid has a molecular weight of 286.29 g/mol, XLogP of -2.60, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4,5-dihydroimidazol-1-yl)acetic acid is sourced from PubChem (CID 21198651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).