C22H30O2 — CID 21199328
1,2-bis(4-tert-butylphenyl)ethane-1,2-diol (PubChem CID 21199328) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 1,2-bis(4-tert-butylphenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(4-tert-butylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 21199328 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 1,2-bis(4-tert-butylphenyl)ethane-1,2-diol |
| SMILES | CC(C)(C)c1ccc(C(O)C(O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H30O2/c1-21(2,3)17-11-7-15(8-12-17)19(23)20(24)16-9-13-18(14-10-16)22(4,5)6/h7-14,19-20,23-24H,1-6H3 |
| InChIKey | WTEHRNXHJOYERJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |