About 3,4-dicyclopentylthiophene
3,4-dicyclopentylthiophene (PubChem CID 21200052) has the molecular formula C14H20S
and a molecular weight of 220.38 g/mol. Its IUPAC name is 3,4-dicyclopentylthiophene.
Molecular Properties
| Compound Name | 3,4-dicyclopentylthiophene |
| PubChem CID | 21200052 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3,4-dicyclopentylthiophene |
| SMILES | c1scc(C2CCCC2)c1C1CCCC1 |
| InChI | InChI=1S/C14H20S/c1-2-6-11(5-1)13-9-15-10-14(13)12-7-3-4-8-12/h9-12H,1-8H2 |
| InChIKey | PNPCNJUBRWYHJV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dicyclopentylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dicyclopentylthiophene?
The IUPAC name of 3,4-dicyclopentylthiophene (CID 21200052) is 3,4-dicyclopentylthiophene.
What is the SMILES notation for 3,4-dicyclopentylthiophene?
The canonical SMILES for 3,4-dicyclopentylthiophene is c1scc(C2CCCC2)c1C1CCCC1.
What is the InChIKey of 3,4-dicyclopentylthiophene?
The InChIKey is PNPCNJUBRWYHJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20S/c1-2-6-11(5-1)13-9-15-10-14(13)12-7-3-4-8-12/h9-12H,1-8H2.
What are the key properties of 3,4-dicyclopentylthiophene?
3,4-dicyclopentylthiophene has a molecular weight of 220.38 g/mol, XLogP of 5.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dicyclopentylthiophene is sourced from PubChem (CID 21200052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).