About 1,4-diiodo-2,3-dimethylbutane
1,4-diiodo-2,3-dimethylbutane (PubChem CID 21200721) has the molecular formula C6H12I2
and a molecular weight of 337.97 g/mol. Its IUPAC name is 1,4-diiodo-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 1,4-diiodo-2,3-dimethylbutane |
| PubChem CID | 21200721 |
| Molecular Formula | C6H12I2 |
| Molecular Weight | 337.97 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 1,4-diiodo-2,3-dimethylbutane |
| SMILES | CC(CI)C(C)CI |
| InChI | InChI=1S/C6H12I2/c1-5(3-7)6(2)4-8/h5-6H,3-4H2,1-2H3 |
| InChIKey | YROMMMDGXYYFAL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.97 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-diiodo-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diiodo-2,3-dimethylbutane?
The IUPAC name of 1,4-diiodo-2,3-dimethylbutane (CID 21200721) is 1,4-diiodo-2,3-dimethylbutane.
What is the SMILES notation for 1,4-diiodo-2,3-dimethylbutane?
The canonical SMILES for 1,4-diiodo-2,3-dimethylbutane is CC(CI)C(C)CI.
What is the InChIKey of 1,4-diiodo-2,3-dimethylbutane?
The InChIKey is YROMMMDGXYYFAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12I2/c1-5(3-7)6(2)4-8/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,4-diiodo-2,3-dimethylbutane?
1,4-diiodo-2,3-dimethylbutane has a molecular weight of 337.97 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diiodo-2,3-dimethylbutane is sourced from PubChem (CID 21200721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).