About 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea
1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea (PubChem CID 2120081) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea.
Molecular Properties
| Compound Name | 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea |
| PubChem CID | 2120081 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea |
| SMILES | COc1ccccc1NC(=O)NNc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H21N3O2/c1-11-9-12(2)16(13(3)10-11)19-20-17(21)18-14-7-5-6-8-15(14)22-4/h5-10,19H,1-4H3,(H2,18,20,21) |
| InChIKey | RRPCYVNBEWKKBZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea?
The IUPAC name of 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea (CID 2120081) is 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea.
What is the SMILES notation for 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea?
The canonical SMILES for 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea is COc1ccccc1NC(=O)NNc1c(C)cc(C)cc1C.
What is the InChIKey of 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea?
The InChIKey is RRPCYVNBEWKKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-11-9-12(2)16(13(3)10-11)19-20-17(21)18-14-7-5-6-8-15(14)22-4/h5-10,19H,1-4H3,(H2,18,20,21).
What are the key properties of 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea?
1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea has a molecular weight of 299.37 g/mol, XLogP of 3.77, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyphenyl)-3-(2,4,6-trimethylanilino)urea is sourced from PubChem (CID 2120081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).