C23H25N3O — CID 21201418
1-[[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]methyl]indole-6-carbonitrile (PubChem CID 21201418) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-[[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]methyl]indole-6-carbonitrile.
| Compound Name | 1-[[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]methyl]indole-6-carbonitrile |
|---|---|
| PubChem CID | 21201418 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[[1-[2-(4-methoxyphenyl)ethyl]pyrrolidin-3-yl]methyl]indole-6-carbonitrile |
| SMILES | COc1ccc(CCN2CCC(Cn3ccc4ccc(C#N)cc43)C2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-27-22-6-3-18(4-7-22)8-11-25-12-9-20(16-25)17-26-13-10-21-5-2-19(15-24)14-23(21)26/h2-7,10,13-14,20H,8-9,11-12,16-17H2,1H3 |
| InChIKey | ZOOBCUVXCIVVLA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |