C8H18N4 — CID 21203092
7-[2-(dimethylamino)hydrazinyl]-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 21203092) has the molecular formula C8H18N4 and a molecular weight of 170.26 g/mol. Its IUPAC name is 7-[2-(dimethylamino)hydrazinyl]-3,4,5,6-tetrahydro-2H-azepine.
| Compound Name | 7-[2-(dimethylamino)hydrazinyl]-3,4,5,6-tetrahydro-2H-azepine |
|---|---|
| PubChem CID | 21203092 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 7-[2-(dimethylamino)hydrazinyl]-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | CN(C)NNC1=NCCCCC1 |
| InChI | InChI=1S/C8H18N4/c1-12(2)11-10-8-6-4-3-5-7-9-8/h11H,3-7H2,1-2H3,(H,9,10) |
| InChIKey | LQQVVIRPJZNMRZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|