C24H17BrClN3O5 — CID 21203234
3-(4-bromophenyl)-2-(4-chlorophenyl)-5-(2-methyl-4-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 21203234) has the molecular formula C24H17BrClN3O5 and a molecular weight of 542.77 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(4-chlorophenyl)-5-(2-methyl-4-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(4-bromophenyl)-2-(4-chlorophenyl)-5-(2-methyl-4-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 21203234 |
| Molecular Formula | C24H17BrClN3O5 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 541.00 |
| IUPAC Name | 3-(4-bromophenyl)-2-(4-chlorophenyl)-5-(2-methyl-4-nitrophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)C2ON(c3ccc(Cl)cc3)C(c3ccc(Br)cc3)C2C1=O |
| InChI | InChI=1S/C24H17BrClN3O5/c1-13-12-18(29(32)33)10-11-19(13)27-23(30)20-21(14-2-4-15(25)5-3-14)28(34-22(20)24(27)31)17-8-6-16(26)7-9-17/h2-12,20-22H,1H3 |
| InChIKey | UYQHDSIBHLESJC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|