C23H22N4O3S2 — CID 2120449
1-benzyl-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,5-dimethylpyrazole-4-carboxamide (PubChem CID 2120449) has the molecular formula C23H22N4O3S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-benzyl-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,5-dimethylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2120449 |
| Molecular Formula | C23H22N4O3S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 1-benzyl-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]-3,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C(=O)NCCN1C(=O)S/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C23H22N4O3S2/c1-15-20(16(2)27(25-15)14-17-7-4-3-5-8-17)21(28)24-10-11-26-22(29)19(32-23(26)30)13-18-9-6-12-31-18/h3-9,12-13H,10-11,14H2,1-2H3,(H,24,28)/b19-13- |
| InChIKey | IWRZKBYICVGPLV-UYRXBGFRSA-N |
| XLogP | 4.08 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|