About N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide
N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide (PubChem CID 2120459) has the molecular formula C20H23N3O4S
and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| PubChem CID | 2120459 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide |
| SMILES | CCOc1ccc2nc(SCC(=O)NCc3ccc(OC)c(OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-4-27-14-6-7-15-16(10-14)23-20(22-15)28-12-19(24)21-11-13-5-8-17(25-2)18(9-13)26-3/h5-10H,4,11-12H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | SJUZRIIBWJGURI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide (CID 2120459) is N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide is CCOc1ccc2nc(SCC(=O)NCc3ccc(OC)c(OC)c3)[nH]c2c1.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide?
The InChIKey is SJUZRIIBWJGURI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O4S/c1-4-27-14-6-7-15-16(10-14)23-20(22-15)28-12-19(24)21-11-13-5-8-17(25-2)18(9-13)26-3/h5-10H,4,11-12H2,1-3H3,(H,21,24)(H,22,23).
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide?
N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide has a molecular weight of 401.49 g/mol, XLogP of 3.39, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]acetamide is sourced from PubChem (CID 2120459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).