About methyl 12-methyltetradecanoate
methyl 12-methyltetradecanoate (PubChem CID 21206) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is methyl 12-methyltetradecanoate.
Molecular Properties
| Compound Name | methyl 12-methyltetradecanoate |
| PubChem CID | 21206 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | methyl 12-methyltetradecanoate |
| SMILES | CCC(C)CCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C16H32O2/c1-4-15(2)13-11-9-7-5-6-8-10-12-14-16(17)18-3/h15H,4-14H2,1-3H3 |
| InChIKey | BJIUDNXPLSJWKE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 12-methyltetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 12-methyltetradecanoate?
The IUPAC name of methyl 12-methyltetradecanoate (CID 21206) is methyl 12-methyltetradecanoate.
What is the SMILES notation for methyl 12-methyltetradecanoate?
The canonical SMILES for methyl 12-methyltetradecanoate is CCC(C)CCCCCCCCCCC(=O)OC.
What is the InChIKey of methyl 12-methyltetradecanoate?
The InChIKey is BJIUDNXPLSJWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-4-15(2)13-11-9-7-5-6-8-10-12-14-16(17)18-3/h15H,4-14H2,1-3H3.
What are the key properties of methyl 12-methyltetradecanoate?
methyl 12-methyltetradecanoate has a molecular weight of 256.43 g/mol, XLogP of 5.11, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 12-methyltetradecanoate is sourced from PubChem (CID 21206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).