About 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide
4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide (PubChem CID 21206497) has the molecular formula C9H18INO4S
and a molecular weight of 363.22 g/mol. Its IUPAC name is 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide.
Molecular Properties
| Compound Name | 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide |
| PubChem CID | 21206497 |
| Molecular Formula | C9H18INO4S |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide |
| SMILES | C[N+]1(C2CS(=O)(=O)CC2O)CCOCC1.[I-] |
| InChI | InChI=1S/C9H18NO4S.HI/c1-10(2-4-14-5-3-10)8-6-15(12,13)7-9(8)11;/h8-9,11H,2-7H2,1H3;1H/q+1;/p-1 |
| InChIKey | IYWPYRINIKCATJ-UHFFFAOYSA-M |
| XLogP | -4.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide?
The IUPAC name of 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide (CID 21206497) is 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide.
What is the SMILES notation for 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide?
The canonical SMILES for 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide is C[N+]1(C2CS(=O)(=O)CC2O)CCOCC1.[I-].
What is the InChIKey of 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide?
The InChIKey is IYWPYRINIKCATJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18NO4S.HI/c1-10(2-4-14-5-3-10)8-6-15(12,13)7-9(8)11;/h8-9,11H,2-7H2,1H3;1H/q+1;/p-1.
What are the key properties of 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide?
4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide has a molecular weight of 363.22 g/mol, XLogP of -4.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylmorpholin-4-ium-4-yl)-1,1-dioxothiolan-3-ol iodide is sourced from PubChem (CID 21206497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).