C10H13F7N2OS — CID 21206559
2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-methylpiperazin-1-yl)ethanone (PubChem CID 21206559) has the molecular formula C10H13F7N2OS and a molecular weight of 342.28 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 21206559 |
| Molecular Formula | C10H13F7N2OS |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropylsulfanyl)-1-(4-methylpiperazin-1-yl)ethanone |
| SMILES | CN1CCN(C(=O)CSC(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F7N2OS/c1-18-2-4-19(5-3-18)7(20)6-21-10(16,17)8(11,12)9(13,14)15/h2-6H2,1H3 |
| InChIKey | CTRBKUHYAANSNK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|