C30H22N4O5S2 — CID 21208322
(2Z)-7-methyl-2-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-N-phenyl-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 21208322) has the molecular formula C30H22N4O5S2 and a molecular weight of 582.66 g/mol. Its IUPAC name is (2Z)-7-methyl-2-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-N-phenyl-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (2Z)-7-methyl-2-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-N-phenyl-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 21208322 |
| Molecular Formula | C30H22N4O5S2 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | (2Z)-7-methyl-2-[[5-(4-methyl-3-nitrophenyl)furan-2-yl]methylidene]-3-oxo-N-phenyl-5-thiophen-2-yl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2cccs2)n2c(s/c(=C\c3ccc(-c4ccc(C)c([N+](=O)[O-])c4)o3)c2=O)=N1 |
| InChI | InChI=1S/C30H22N4O5S2/c1-17-10-11-19(15-22(17)34(37)38)23-13-12-21(39-23)16-25-29(36)33-27(24-9-6-14-40-24)26(18(2)31-30(33)41-25)28(35)32-20-7-4-3-5-8-20/h3-16,27H,1-2H3,(H,32,35)/b25-16- |
| InChIKey | UDBCOVBPQHBYQG-XYGWBWBKSA-N |
| XLogP | 5.41 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|