C35H31Cl2N3O5S — CID 21208834
(2E)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-7-methyl-6-propanoyl-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 21208834) has the molecular formula C35H31Cl2N3O5S and a molecular weight of 676.62 g/mol. Its IUPAC name is (2E)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-7-methyl-6-propanoyl-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | (2E)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-7-methyl-6-propanoyl-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 21208834 |
| Molecular Formula | C35H31Cl2N3O5S |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 675.14 |
| IUPAC Name | (2E)-2-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-7-methyl-6-propanoyl-5-(3,4,5-trimethoxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | CCC(=O)C1=C(C)N=c2s/c(=C/c3cn(Cc4ccc(Cl)c(Cl)c4)c4ccccc34)c(=O)n2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C35H31Cl2N3O5S/c1-6-27(41)31-19(2)38-35-40(32(31)21-14-28(43-3)33(45-5)29(15-21)44-4)34(42)30(46-35)16-22-18-39(26-10-8-7-9-23(22)26)17-20-11-12-24(36)25(37)13-20/h7-16,18,32H,6,17H2,1-5H3/b30-16+ |
| InChIKey | OMBANTZQGBTYSE-OKCVXOCRSA-N |
| XLogP | 6.55 |
| TPSA | 84.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |